C10H20N2O4 — CID 131977674
methyl (2S)-2-amino-3-(2-methylbutan-2-yloxycarbonylamino)propanoate (PubChem CID 131977674) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(2-methylbutan-2-yloxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(2-methylbutan-2-yloxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 131977674 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | methyl (2S)-2-amino-3-(2-methylbutan-2-yloxycarbonylamino)propanoate |
| SMILES | CCC(C)(C)OC(=O)NC[C@H](N)C(=O)OC |
| InChI | InChI=1S/C10H20N2O4/c1-5-10(2,3)16-9(14)12-6-7(11)8(13)15-4/h7H,5-6,11H2,1-4H3,(H,12,14)/t7-/m0/s1 |
| InChIKey | JRNZIMUBVAXRQL-ZETCQYMHSA-N |
| XLogP | 0.40 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |