About bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate
bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate (PubChem CID 58846952) has the molecular formula C20H38O6
and a molecular weight of 374.52 g/mol. Its IUPAC name is bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate.
Molecular Properties
| Compound Name | bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate |
| PubChem CID | 58846952 |
| Molecular Formula | C20H38O6 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate |
| SMILES | CCC(C)(C)OOCC(CC(=O)OC(C)(C)CC)C(=O)OC(C)(C)CC |
| InChI | InChI=1S/C20H38O6/c1-10-18(4,5)24-16(21)13-15(14-23-26-20(8,9)12-3)17(22)25-19(6,7)11-2/h15H,10-14H2,1-9H3 |
| InChIKey | LXQZPGSWUREOFC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate?
The IUPAC name of bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate (CID 58846952) is bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate.
What is the SMILES notation for bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate?
The canonical SMILES for bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate is CCC(C)(C)OOCC(CC(=O)OC(C)(C)CC)C(=O)OC(C)(C)CC.
What is the InChIKey of bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate?
The InChIKey is LXQZPGSWUREOFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O6/c1-10-18(4,5)24-16(21)13-15(14-23-26-20(8,9)12-3)17(22)25-19(6,7)11-2/h15H,10-14H2,1-9H3.
What are the key properties of bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate?
bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate has a molecular weight of 374.52 g/mol, XLogP of 4.59, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylbutan-2-yl) 2-(2-methylbutan-2-ylperoxymethyl)butanedioate is sourced from PubChem (CID 58846952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).