C19H42O5 — CID 142102526
methanediol;2-methylbutan-2-yl (3R,5S)-3-ethyl-5-(hydroxymethyl)heptanoate;propane (PubChem CID 142102526) has the molecular formula C19H42O5 and a molecular weight of 350.54 g/mol. Its IUPAC name is methanediol;2-methylbutan-2-yl (3R,5S)-3-ethyl-5-(hydroxymethyl)heptanoate;propane.
| Compound Name | methanediol;2-methylbutan-2-yl (3R,5S)-3-ethyl-5-(hydroxymethyl)heptanoate;propane |
|---|---|
| PubChem CID | 142102526 |
| Molecular Formula | C19H42O5 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | methanediol;2-methylbutan-2-yl (3R,5S)-3-ethyl-5-(hydroxymethyl)heptanoate;propane |
| SMILES | CCC.CC[C@H](CO)C[C@@H](CC)CC(=O)OC(C)(C)CC.OCO |
| InChI | InChI=1S/C15H30O3.C3H8.CH4O2/c1-6-12(9-13(7-2)11-16)10-14(17)18-15(4,5)8-3;1-3-2;2-1-3/h12-13,16H,6-11H2,1-5H3;3H2,1-2H3;2-3H,1H2/t12-,13+;;/m1../s1 |
| InChIKey | DIRFBTLISSWTKC-VAALMUBNSA-N |
| XLogP | 3.89 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|