C24H46O4 — CID 88735884
(3,5-diethyl-5-methylheptanoyl) 3,5-diethyl-5-methylheptaneperoxoate (PubChem CID 88735884) has the molecular formula C24H46O4 and a molecular weight of 398.63 g/mol. Its IUPAC name is (3,5-diethyl-5-methylheptanoyl) 3,5-diethyl-5-methylheptaneperoxoate.
| Compound Name | (3,5-diethyl-5-methylheptanoyl) 3,5-diethyl-5-methylheptaneperoxoate |
|---|---|
| PubChem CID | 88735884 |
| Molecular Formula | C24H46O4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | (3,5-diethyl-5-methylheptanoyl) 3,5-diethyl-5-methylheptaneperoxoate |
| SMILES | CCC(CC(=O)OOC(=O)CC(CC)CC(C)(CC)CC)CC(C)(CC)CC |
| InChI | InChI=1S/C24H46O4/c1-9-19(17-23(7,11-3)12-4)15-21(25)27-28-22(26)16-20(10-2)18-24(8,13-5)14-6/h19-20H,9-18H2,1-8H3 |
| InChIKey | ITFSHNDTMCETFP-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|