About tert-butyl 3-ethylheptanoate
tert-butyl 3-ethylheptanoate (PubChem CID 545580) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is tert-butyl 3-ethylheptanoate.
Molecular Properties
| Compound Name | tert-butyl 3-ethylheptanoate |
| PubChem CID | 545580 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | tert-butyl 3-ethylheptanoate |
| SMILES | CCCCC(CC)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-6-8-9-11(7-2)10-12(14)15-13(3,4)5/h11H,6-10H2,1-5H3 |
| InChIKey | DYNABLLWIDHPDH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 3-ethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-ethylheptanoate?
The IUPAC name of tert-butyl 3-ethylheptanoate (CID 545580) is tert-butyl 3-ethylheptanoate.
What is the SMILES notation for tert-butyl 3-ethylheptanoate?
The canonical SMILES for tert-butyl 3-ethylheptanoate is CCCCC(CC)CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3-ethylheptanoate?
The InChIKey is DYNABLLWIDHPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-6-8-9-11(7-2)10-12(14)15-13(3,4)5/h11H,6-10H2,1-5H3.
What are the key properties of tert-butyl 3-ethylheptanoate?
tert-butyl 3-ethylheptanoate has a molecular weight of 214.35 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-ethylheptanoate is sourced from PubChem (CID 545580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).