C15H30O2 — CID 116709605
6-ethyl-3-methoxy-2,2-dimethyldecan-4-one (PubChem CID 116709605) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 6-ethyl-3-methoxy-2,2-dimethyldecan-4-one.
| Compound Name | 6-ethyl-3-methoxy-2,2-dimethyldecan-4-one |
|---|---|
| PubChem CID | 116709605 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 6-ethyl-3-methoxy-2,2-dimethyldecan-4-one |
| SMILES | CCCCC(CC)CC(=O)C(OC)C(C)(C)C |
| InChI | InChI=1S/C15H30O2/c1-7-9-10-12(8-2)11-13(16)14(17-6)15(3,4)5/h12,14H,7-11H2,1-6H3 |
| InChIKey | FYQUASMOKXXDFO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |