About (5R)-5-ethyl-2,2-dimethyldecan-3-one
(5R)-5-ethyl-2,2-dimethyldecan-3-one (PubChem CID 101155077) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is (5R)-5-ethyl-2,2-dimethyldecan-3-one.
Molecular Properties
| Compound Name | (5R)-5-ethyl-2,2-dimethyldecan-3-one |
| PubChem CID | 101155077 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (5R)-5-ethyl-2,2-dimethyldecan-3-one |
| SMILES | CCCCC[C@@H](CC)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H28O/c1-6-8-9-10-12(7-2)11-13(15)14(3,4)5/h12H,6-11H2,1-5H3/t12-/m1/s1 |
| InChIKey | LBFAEBYTDMDZGE-GFCCVEGCSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-ethyl-2,2-dimethyldecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-ethyl-2,2-dimethyldecan-3-one?
The IUPAC name of (5R)-5-ethyl-2,2-dimethyldecan-3-one (CID 101155077) is (5R)-5-ethyl-2,2-dimethyldecan-3-one.
What is the SMILES notation for (5R)-5-ethyl-2,2-dimethyldecan-3-one?
The canonical SMILES for (5R)-5-ethyl-2,2-dimethyldecan-3-one is CCCCC[C@@H](CC)CC(=O)C(C)(C)C.
What is the InChIKey of (5R)-5-ethyl-2,2-dimethyldecan-3-one?
The InChIKey is LBFAEBYTDMDZGE-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H28O/c1-6-8-9-10-12(7-2)11-13(15)14(3,4)5/h12H,6-11H2,1-5H3/t12-/m1/s1.
What are the key properties of (5R)-5-ethyl-2,2-dimethyldecan-3-one?
(5R)-5-ethyl-2,2-dimethyldecan-3-one has a molecular weight of 212.38 g/mol, XLogP of 4.60, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-ethyl-2,2-dimethyldecan-3-one is sourced from PubChem (CID 101155077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).