C13H26O2 — CID 116709581
6-ethyl-3-methoxy-2,2-dimethyloctan-4-one (PubChem CID 116709581) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 6-ethyl-3-methoxy-2,2-dimethyloctan-4-one.
| Compound Name | 6-ethyl-3-methoxy-2,2-dimethyloctan-4-one |
|---|---|
| PubChem CID | 116709581 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 6-ethyl-3-methoxy-2,2-dimethyloctan-4-one |
| SMILES | CCC(CC)CC(=O)C(OC)C(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-7-10(8-2)9-11(14)12(15-6)13(3,4)5/h10,12H,7-9H2,1-6H3 |
| InChIKey | HEYKVLVRWXMTBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |