C12H22O2 — CID 116709725
1-cyclobutyl-3-methoxy-4,4-dimethylpentan-2-one (PubChem CID 116709725) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-cyclobutyl-3-methoxy-4,4-dimethylpentan-2-one.
| Compound Name | 1-cyclobutyl-3-methoxy-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 116709725 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1-cyclobutyl-3-methoxy-4,4-dimethylpentan-2-one |
| SMILES | COC(C(=O)CC1CCC1)C(C)(C)C |
| InChI | InChI=1S/C12H22O2/c1-12(2,3)11(14-4)10(13)8-9-6-5-7-9/h9,11H,5-8H2,1-4H3 |
| InChIKey | SJCWVIAJYWCUQS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |