C16H30O2 — CID 59143648
3-(cyclopentylmethoxy)-2,2,6-trimethylheptan-4-one (PubChem CID 59143648) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 3-(cyclopentylmethoxy)-2,2,6-trimethylheptan-4-one.
| Compound Name | 3-(cyclopentylmethoxy)-2,2,6-trimethylheptan-4-one |
|---|---|
| PubChem CID | 59143648 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 3-(cyclopentylmethoxy)-2,2,6-trimethylheptan-4-one |
| SMILES | CC(C)CC(=O)C(OCC1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C16H30O2/c1-12(2)10-14(17)15(16(3,4)5)18-11-13-8-6-7-9-13/h12-13,15H,6-11H2,1-5H3 |
| InChIKey | ZJZSZYOKLIHUCI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |