About 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide
2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide (PubChem CID 21366296) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide |
| PubChem CID | 21366296 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide |
| SMILES | CC(C)NC(=O)C(OCC1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C15H29NO2/c1-11(2)16-14(17)13(15(3,4)5)18-10-12-8-6-7-9-12/h11-13H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | HNOHVFIRUQJNBD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide?
The IUPAC name of 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide (CID 21366296) is 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide.
What is the SMILES notation for 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide?
The canonical SMILES for 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide is CC(C)NC(=O)C(OCC1CCCC1)C(C)(C)C.
What is the InChIKey of 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide?
The InChIKey is HNOHVFIRUQJNBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-11(2)16-14(17)13(15(3,4)5)18-10-12-8-6-7-9-12/h11-13H,6-10H2,1-5H3,(H,16,17).
What are the key properties of 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide?
2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide has a molecular weight of 255.40 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylmethoxy)-3,3-dimethyl-N-propan-2-ylbutanamide is sourced from PubChem (CID 21366296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).