C18H33NO2 — CID 20790258
N-tert-butyl-3-cyclopentyl-2-(cyclopentylmethoxy)propanamide (PubChem CID 20790258) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is N-tert-butyl-3-cyclopentyl-2-(cyclopentylmethoxy)propanamide.
| Compound Name | N-tert-butyl-3-cyclopentyl-2-(cyclopentylmethoxy)propanamide |
|---|---|
| PubChem CID | 20790258 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | N-tert-butyl-3-cyclopentyl-2-(cyclopentylmethoxy)propanamide |
| SMILES | CC(C)(C)NC(=O)C(CC1CCCC1)OCC1CCCC1 |
| InChI | InChI=1S/C18H33NO2/c1-18(2,3)19-17(20)16(12-14-8-4-5-9-14)21-13-15-10-6-7-11-15/h14-16H,4-13H2,1-3H3,(H,19,20) |
| InChIKey | LUMMPYDDPACCFI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |