C18H34O2 — CID 173240680
tert-butyl (3R)-6-cyclohexyl-3-ethylhexanoate (PubChem CID 173240680) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is tert-butyl (3R)-6-cyclohexyl-3-ethylhexanoate.
| Compound Name | tert-butyl (3R)-6-cyclohexyl-3-ethylhexanoate |
|---|---|
| PubChem CID | 173240680 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | tert-butyl (3R)-6-cyclohexyl-3-ethylhexanoate |
| SMILES | CC[C@H](CCCC1CCCCC1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34O2/c1-5-15(14-17(19)20-18(2,3)4)12-9-13-16-10-7-6-8-11-16/h15-16H,5-14H2,1-4H3/t15-/m1/s1 |
| InChIKey | IZLPCFIKWFDXBM-OAHLLOKOSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |