C24H43N3O6S — CID 16749428
1-O-[(Z)-[amino-(1-methylsulfonylpiperidin-4-yl)methylidene]amino] 4-O-tert-butyl (2R)-2-(3-cyclohexylpropyl)butanedioate (PubChem CID 16749428) has the molecular formula C24H43N3O6S and a molecular weight of 501.69 g/mol. Its IUPAC name is 1-O-[(Z)-[amino-(1-methylsulfonylpiperidin-4-yl)methylidene]amino] 4-O-tert-butyl (2R)-2-(3-cyclohexylpropyl)butanedioate.
| Compound Name | 1-O-[(Z)-[amino-(1-methylsulfonylpiperidin-4-yl)methylidene]amino] 4-O-tert-butyl (2R)-2-(3-cyclohexylpropyl)butanedioate |
|---|---|
| PubChem CID | 16749428 |
| Molecular Formula | C24H43N3O6S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 1-O-[(Z)-[amino-(1-methylsulfonylpiperidin-4-yl)methylidene]amino] 4-O-tert-butyl (2R)-2-(3-cyclohexylpropyl)butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CCCC1CCCCC1)C(=O)O/N=C(\N)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C24H43N3O6S/c1-24(2,3)32-21(28)17-20(12-8-11-18-9-6-5-7-10-18)23(29)33-26-22(25)19-13-15-27(16-14-19)34(4,30)31/h18-20H,5-17H2,1-4H3,(H2,25,26)/t20-/m1/s1 |
| InChIKey | RNVJMYFCHQHWDN-HXUWFJFHSA-N |
| XLogP | 3.57 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|