C23H35N3O4 — CID 22770799
1-O-[(Z)-[amino(pyridin-2-yl)methylidene]amino] 4-O-tert-butyl (2S)-2-(3-cyclohexylpropyl)butanedioate (PubChem CID 22770799) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-O-[(Z)-[amino(pyridin-2-yl)methylidene]amino] 4-O-tert-butyl (2S)-2-(3-cyclohexylpropyl)butanedioate.
| Compound Name | 1-O-[(Z)-[amino(pyridin-2-yl)methylidene]amino] 4-O-tert-butyl (2S)-2-(3-cyclohexylpropyl)butanedioate |
|---|---|
| PubChem CID | 22770799 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 1-O-[(Z)-[amino(pyridin-2-yl)methylidene]amino] 4-O-tert-butyl (2S)-2-(3-cyclohexylpropyl)butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CCCC1CCCCC1)C(=O)O/N=C(\N)c1ccccn1 |
| InChI | InChI=1S/C23H35N3O4/c1-23(2,3)29-20(27)16-18(13-9-12-17-10-5-4-6-11-17)22(28)30-26-21(24)19-14-7-8-15-25-19/h7-8,14-15,17-18H,4-6,9-13,16H2,1-3H3,(H2,24,26)/t18-/m0/s1 |
| InChIKey | GJLORKOYSVGJFD-SFHVURJKSA-N |
| XLogP | 4.34 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|