C24H36N4O3S — CID 142148139
tert-butyl (3R)-6-cyclohexyl-3-[3-[(pyridin-2-ylsulfanylamino)methyl]-1,2,4-oxadiazol-5-yl]hexanoate (PubChem CID 142148139) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is tert-butyl (3R)-6-cyclohexyl-3-[3-[(pyridin-2-ylsulfanylamino)methyl]-1,2,4-oxadiazol-5-yl]hexanoate.
| Compound Name | tert-butyl (3R)-6-cyclohexyl-3-[3-[(pyridin-2-ylsulfanylamino)methyl]-1,2,4-oxadiazol-5-yl]hexanoate |
|---|---|
| PubChem CID | 142148139 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | tert-butyl (3R)-6-cyclohexyl-3-[3-[(pyridin-2-ylsulfanylamino)methyl]-1,2,4-oxadiazol-5-yl]hexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CCCC1CCCCC1)c1nc(CNSc2ccccn2)no1 |
| InChI | InChI=1S/C24H36N4O3S/c1-24(2,3)30-22(29)16-19(13-9-12-18-10-5-4-6-11-18)23-27-20(28-31-23)17-26-32-21-14-7-8-15-25-21/h7-8,14-15,18-19,26H,4-6,9-13,16-17H2,1-3H3/t19-/m1/s1 |
| InChIKey | NJJGMWUFVWWXPD-LJQANCHMSA-N |
| XLogP | 5.83 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|