C26H39N2O6S+ — CID 163575482
[5-[(3R)-6-cyclohexyl-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methyl-(4-methylphenyl)sulfonyloxidanium (PubChem CID 163575482) has the molecular formula C26H39N2O6S+ and a molecular weight of 507.67 g/mol. Its IUPAC name is [5-[(3R)-6-cyclohexyl-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methyl-(4-methylphenyl)sulfonyloxidanium.
| Compound Name | [5-[(3R)-6-cyclohexyl-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methyl-(4-methylphenyl)sulfonyloxidanium |
|---|---|
| PubChem CID | 163575482 |
| Molecular Formula | C26H39N2O6S+ |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | [5-[(3R)-6-cyclohexyl-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methyl-(4-methylphenyl)sulfonyloxidanium |
| SMILES | Cc1ccc(S(=O)(=O)[OH+]Cc2noc([C@H](CCCC3CCCCC3)CC(=O)OC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C26H38N2O6S/c1-19-13-15-22(16-14-19)35(30,31)32-18-23-27-25(34-28-23)21(17-24(29)33-26(2,3)4)12-8-11-20-9-6-5-7-10-20/h13-16,20-21H,5-12,17-18H2,1-4H3/p+1/t21-/m1/s1 |
| InChIKey | GDCDMIWAQRJMFA-OAQYLSRUSA-O |
| XLogP | 5.36 |
| TPSA | 112.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|