C23H32N2O5S — CID 21305052
[5-(1-cyclohexyl-6-oxoheptan-4-yl)-1,2,4-oxadiazol-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 21305052) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is [5-(1-cyclohexyl-6-oxoheptan-4-yl)-1,2,4-oxadiazol-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [5-(1-cyclohexyl-6-oxoheptan-4-yl)-1,2,4-oxadiazol-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 21305052 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [5-(1-cyclohexyl-6-oxoheptan-4-yl)-1,2,4-oxadiazol-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CC(=O)CC(CCCC1CCCCC1)c1nc(COS(=O)(=O)c2ccc(C)cc2)no1 |
| InChI | InChI=1S/C23H32N2O5S/c1-17-11-13-21(14-12-17)31(27,28)29-16-22-24-23(30-25-22)20(15-18(2)26)10-6-9-19-7-4-3-5-8-19/h11-14,19-20H,3-10,15-16H2,1-2H3 |
| InChIKey | LCPCFJOERWZXCX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|