C26H37N2O6S- — CID 21094489
6-(1-tert-butylcyclohexyl)-3-[3-[(4-methylphenyl)sulfonyloxymethyl]-1,2,4-oxadiazol-5-yl]hexanoate (PubChem CID 21094489) has the molecular formula C26H37N2O6S- and a molecular weight of 505.66 g/mol. Its IUPAC name is 6-(1-tert-butylcyclohexyl)-3-[3-[(4-methylphenyl)sulfonyloxymethyl]-1,2,4-oxadiazol-5-yl]hexanoate.
| Compound Name | 6-(1-tert-butylcyclohexyl)-3-[3-[(4-methylphenyl)sulfonyloxymethyl]-1,2,4-oxadiazol-5-yl]hexanoate |
|---|---|
| PubChem CID | 21094489 |
| Molecular Formula | C26H37N2O6S- |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 6-(1-tert-butylcyclohexyl)-3-[3-[(4-methylphenyl)sulfonyloxymethyl]-1,2,4-oxadiazol-5-yl]hexanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2noc(C(CCCC3(C(C)(C)C)CCCCC3)CC(=O)[O-])n2)cc1 |
| InChI | InChI=1S/C26H38N2O6S/c1-19-10-12-21(13-11-19)35(31,32)33-18-22-27-24(34-28-22)20(17-23(29)30)9-8-16-26(25(2,3)4)14-6-5-7-15-26/h10-13,20H,5-9,14-18H2,1-4H3,(H,29,30)/p-1 |
| InChIKey | UMINLFMOUHHKBT-UHFFFAOYSA-M |
| XLogP | 4.67 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|