C15H15NO5S — CID 86669584
[3-(2-hydroxybut-3-yn-2-yl)-1,2-oxazol-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 86669584) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is [3-(2-hydroxybut-3-yn-2-yl)-1,2-oxazol-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-(2-hydroxybut-3-yn-2-yl)-1,2-oxazol-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86669584 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | [3-(2-hydroxybut-3-yn-2-yl)-1,2-oxazol-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C#CC(C)(O)c1cc(COS(=O)(=O)c2ccc(C)cc2)on1 |
| InChI | InChI=1S/C15H15NO5S/c1-4-15(3,17)14-9-12(21-16-14)10-20-22(18,19)13-7-5-11(2)6-8-13/h1,5-9,17H,10H2,2-3H3 |
| InChIKey | IYXILYVCUFFYHR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|