C17H28N2O2 — CID 58860994
(4R)-7-cyclohexyl-4-(3-ethyl-1,2,4-oxadiazol-5-yl)heptan-2-one (PubChem CID 58860994) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (4R)-7-cyclohexyl-4-(3-ethyl-1,2,4-oxadiazol-5-yl)heptan-2-one.
| Compound Name | (4R)-7-cyclohexyl-4-(3-ethyl-1,2,4-oxadiazol-5-yl)heptan-2-one |
|---|---|
| PubChem CID | 58860994 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (4R)-7-cyclohexyl-4-(3-ethyl-1,2,4-oxadiazol-5-yl)heptan-2-one |
| SMILES | CCc1noc([C@H](CCCC2CCCCC2)CC(C)=O)n1 |
| InChI | InChI=1S/C17H28N2O2/c1-3-16-18-17(21-19-16)15(12-13(2)20)11-7-10-14-8-5-4-6-9-14/h14-15H,3-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | MUUSIPBCDHSBHV-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |