C34H56N6O8 — CID 90905609
3-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]propanoic acid;(3R)-6-cyclohexyl-N-hydroxy-3-(3-propyl-1,2,4-oxadiazol-5-yl)hexanamide (PubChem CID 90905609) has the molecular formula C34H56N6O8 and a molecular weight of 676.86 g/mol. Its IUPAC name is 3-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]propanoic acid;(3R)-6-cyclohexyl-N-hydroxy-3-(3-propyl-1,2,4-oxadiazol-5-yl)hexanamide.
| Compound Name | 3-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]propanoic acid;(3R)-6-cyclohexyl-N-hydroxy-3-(3-propyl-1,2,4-oxadiazol-5-yl)hexanamide |
|---|---|
| PubChem CID | 90905609 |
| Molecular Formula | C34H56N6O8 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.42 |
| IUPAC Name | 3-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]propanoic acid;(3R)-6-cyclohexyl-N-hydroxy-3-(3-propyl-1,2,4-oxadiazol-5-yl)hexanamide |
| SMILES | CCCc1noc([C@H](CCCC2CCCCC2)CC(=O)NO)n1.O=C(O)CCc1noc([C@H](CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C17H27N3O5.C17H29N3O3/c21-15(19-24)11-13(8-4-7-12-5-2-1-3-6-12)17-18-14(20-25-17)9-10-16(22)23;1-2-7-15-18-17(23-20-15)14(12-16(21)19-22)11-6-10-13-8-4-3-5-9-13/h12-13,24H,1-11H2,(H,19,21)(H,22,23);13-14,22H,2-12H2,1H3,(H,19,21)/t13-;14-/m11/s1 |
| InChIKey | XPHUZHDDTHKLPO-PZDXOQIKSA-N |
| XLogP | 6.57 |
| TPSA | 213.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|