C18H29N3O6 — CID 10271301
methyl 2-[[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methoxy]acetate (PubChem CID 10271301) has the molecular formula C18H29N3O6 and a molecular weight of 383.45 g/mol. Its IUPAC name is methyl 2-[[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methoxy]acetate.
| Compound Name | methyl 2-[[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methoxy]acetate |
|---|---|
| PubChem CID | 10271301 |
| Molecular Formula | C18H29N3O6 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | methyl 2-[[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methoxy]acetate |
| SMILES | COC(=O)COCc1noc([C@H](CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C18H29N3O6/c1-25-17(23)12-26-11-15-19-18(27-21-15)14(10-16(22)20-24)9-5-8-13-6-3-2-4-7-13/h13-14,24H,2-12H2,1H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | KMCLPPJSYHZNCY-CQSZACIVSA-N |
| XLogP | 2.49 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|