C18H30N4O5 — CID 21305061
methyl 2-[[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methylamino]acetate (PubChem CID 21305061) has the molecular formula C18H30N4O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl 2-[[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methylamino]acetate.
| Compound Name | methyl 2-[[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methylamino]acetate |
|---|---|
| PubChem CID | 21305061 |
| Molecular Formula | C18H30N4O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | methyl 2-[[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]methylamino]acetate |
| SMILES | COC(=O)CNCc1noc(C(CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C18H30N4O5/c1-26-17(24)12-19-11-15-20-18(27-22-15)14(10-16(23)21-25)9-5-8-13-6-3-2-4-7-13/h13-14,19,25H,2-12H2,1H3,(H,21,23) |
| InChIKey | JDCZFJLHGKUITG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|