C20H28N4O3 — CID 22480863
6-cyclohexyl-N-hydroxy-3-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]hexanamide (PubChem CID 22480863) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 6-cyclohexyl-N-hydroxy-3-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]hexanamide.
| Compound Name | 6-cyclohexyl-N-hydroxy-3-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 22480863 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 6-cyclohexyl-N-hydroxy-3-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]hexanamide |
| SMILES | O=C(CC(CCCC1CCCCC1)c1nc(Cc2cccnc2)no1)NO |
| InChI | InChI=1S/C20H28N4O3/c25-19(23-26)13-17(10-4-8-15-6-2-1-3-7-15)20-22-18(24-27-20)12-16-9-5-11-21-14-16/h5,9,11,14-15,17,26H,1-4,6-8,10,12-13H2,(H,23,25) |
| InChIKey | RVWAKNLWMSGWFK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|