C19H27N5O3 — CID 23526916
6-cyclohexyl-N-hydroxy-3-[3-(6-methylpyridazin-3-yl)-1,2,4-oxadiazol-5-yl]hexanamide (PubChem CID 23526916) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 6-cyclohexyl-N-hydroxy-3-[3-(6-methylpyridazin-3-yl)-1,2,4-oxadiazol-5-yl]hexanamide.
| Compound Name | 6-cyclohexyl-N-hydroxy-3-[3-(6-methylpyridazin-3-yl)-1,2,4-oxadiazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 23526916 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 6-cyclohexyl-N-hydroxy-3-[3-(6-methylpyridazin-3-yl)-1,2,4-oxadiazol-5-yl]hexanamide |
| SMILES | Cc1ccc(-c2noc(C(CCCC3CCCCC3)CC(=O)NO)n2)nn1 |
| InChI | InChI=1S/C19H27N5O3/c1-13-10-11-16(22-21-13)18-20-19(27-24-18)15(12-17(25)23-26)9-5-8-14-6-3-2-4-7-14/h10-11,14-15,26H,2-9,12H2,1H3,(H,23,25) |
| InChIKey | LXTLKPYLWDWBMH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|