C22H31N5O4 — CID 135754561
2-[5-[(3S)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-N,N-dimethylpyridine-4-carboxamide (PubChem CID 135754561) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[5-[(3S)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-N,N-dimethylpyridine-4-carboxamide.
| Compound Name | 2-[5-[(3S)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-N,N-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 135754561 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[5-[(3S)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]-N,N-dimethylpyridine-4-carboxamide |
| SMILES | CN(C)C(=O)c1ccnc(-c2noc([C@@H](CCCC3CCCCC3)CC(=O)NO)n2)c1 |
| InChI | InChI=1S/C22H31N5O4/c1-27(2)22(29)17-11-12-23-18(13-17)20-24-21(31-26-20)16(14-19(28)25-30)10-6-9-15-7-4-3-5-8-15/h11-13,15-16,30H,3-10,14H2,1-2H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | VUBHKYSJVINZSX-INIZCTEOSA-N |
| XLogP | 3.56 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|