C22H30N4O5 — CID 10202978
ethyl 5-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]pyridine-3-carboxylate (PubChem CID 10202978) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is ethyl 5-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10202978 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | ethyl 5-[5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazol-3-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cncc(-c2noc([C@H](CCCC3CCCCC3)CC(=O)NO)n2)c1 |
| InChI | InChI=1S/C22H30N4O5/c1-2-30-22(28)18-11-17(13-23-14-18)20-24-21(31-26-20)16(12-19(27)25-29)10-6-9-15-7-4-3-5-8-15/h11,13-16,29H,2-10,12H2,1H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | XIYNNLLLLPFZMB-MRXNPFEDSA-N |
| XLogP | 4.04 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|