C23H33N3O2 — CID 142173363
10-cyclohexyl-7-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)decan-5-one (PubChem CID 142173363) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 10-cyclohexyl-7-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)decan-5-one.
| Compound Name | 10-cyclohexyl-7-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)decan-5-one |
|---|---|
| PubChem CID | 142173363 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 10-cyclohexyl-7-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)decan-5-one |
| SMILES | CCCCC(=O)CC(CCCC1CCCCC1)c1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C23H33N3O2/c1-2-3-14-20(27)17-19(13-9-12-18-10-5-4-6-11-18)23-25-22(26-28-23)21-15-7-8-16-24-21/h7-8,15-16,18-19H,2-6,9-14,17H2,1H3 |
| InChIKey | PXPJEZNCJPKSBI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |