C18H24N4O3 — CID 135712659
(3S)-6-cyclohexyl-3-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)hexanoic acid (PubChem CID 135712659) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is (3S)-6-cyclohexyl-3-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)hexanoic acid.
| Compound Name | (3S)-6-cyclohexyl-3-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)hexanoic acid |
|---|---|
| PubChem CID | 135712659 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (3S)-6-cyclohexyl-3-(3-pyrimidin-2-yl-1,2,4-oxadiazol-5-yl)hexanoic acid |
| SMILES | O=C(O)C[C@H](CCCC1CCCCC1)c1nc(-c2ncccn2)no1 |
| InChI | InChI=1S/C18H24N4O3/c23-15(24)12-14(9-4-8-13-6-2-1-3-7-13)18-21-17(22-25-18)16-19-10-5-11-20-16/h5,10-11,13-14H,1-4,6-9,12H2,(H,23,24)/t14-/m0/s1 |
| InChIKey | GTHPAWXERFKIAI-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |