C19H31N7O3 — CID 23526910
3-[3-(2-tert-butyltetrazol-5-yl)-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide (PubChem CID 23526910) has the molecular formula C19H31N7O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-[3-(2-tert-butyltetrazol-5-yl)-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide.
| Compound Name | 3-[3-(2-tert-butyltetrazol-5-yl)-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 23526910 |
| Molecular Formula | C19H31N7O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 3-[3-(2-tert-butyltetrazol-5-yl)-1,2,4-oxadiazol-5-yl]-6-cyclohexyl-N-hydroxyhexanamide |
| SMILES | CC(C)(C)n1nnc(-c2noc(C(CCCC3CCCCC3)CC(=O)NO)n2)n1 |
| InChI | InChI=1S/C19H31N7O3/c1-19(2,3)26-22-17(21-25-26)16-20-18(29-24-16)14(12-15(27)23-28)11-7-10-13-8-5-4-6-9-13/h13-14,28H,4-12H2,1-3H3,(H,23,27) |
| InChIKey | XSFBPCJRDAOWTD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|