C20H30N4O6 — CID 23378059
methyl 1-[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carbonyl]azetidine-3-carboxylate (PubChem CID 23378059) has the molecular formula C20H30N4O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl 1-[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carbonyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carbonyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 23378059 |
| Molecular Formula | C20H30N4O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | methyl 1-[5-[6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-1,2,4-oxadiazole-3-carbonyl]azetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2noc(C(CCCC3CCCCC3)CC(=O)NO)n2)C1 |
| InChI | InChI=1S/C20H30N4O6/c1-29-20(27)15-11-24(12-15)19(26)17-21-18(30-23-17)14(10-16(25)22-28)9-5-8-13-6-3-2-4-7-13/h13-15,28H,2-12H2,1H3,(H,22,25) |
| InChIKey | ZNCOYFLGZOWPTN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|