C21H30N4O3 — CID 10293538
(4R)-7-cyclohexyl-1-(hydroxyamino)-4-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]heptan-2-one (PubChem CID 10293538) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is (4R)-7-cyclohexyl-1-(hydroxyamino)-4-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]heptan-2-one.
| Compound Name | (4R)-7-cyclohexyl-1-(hydroxyamino)-4-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]heptan-2-one |
|---|---|
| PubChem CID | 10293538 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (4R)-7-cyclohexyl-1-(hydroxyamino)-4-[3-(pyridin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]heptan-2-one |
| SMILES | O=C(CNO)C[C@@H](CCCC1CCCCC1)c1nc(Cc2cccnc2)no1 |
| InChI | InChI=1S/C21H30N4O3/c26-19(15-23-27)13-18(10-4-8-16-6-2-1-3-7-16)21-24-20(25-28-21)12-17-9-5-11-22-14-17/h5,9,11,14,16,18,23,27H,1-4,6-8,10,12-13,15H2/t18-/m1/s1 |
| InChIKey | GHXOVJBCTGNQSK-GOSISDBHSA-N |
| XLogP | 3.83 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|