C23H41N4O5S- — CID 163768105
CID 163768105 (PubChem CID 163768105) has the molecular formula C23H41N4O5S- and a molecular weight of 485.67 g/mol.
| Compound Name | CID 163768105 |
|---|---|
| PubChem CID | 163768105 |
| Molecular Formula | C23H41N4O5S- |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)CC(CCCC1CCCCC1)c1nc(CN/[S-](=O)=[N+](\[O-])C(C)(C)C)no1 |
| InChI | InChI=1S/C23H41N4O5S/c1-22(2,3)27(29)33(30)24-16-19-25-21(32-26-19)18(15-20(28)31-23(4,5)6)14-10-13-17-11-8-7-9-12-17/h17-18H,7-16H2,1-6H3,(H,24,30)/q-1 |
| InChIKey | HVXKJGGVKRDAHN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|