C30H39N3O4 — CID 173184371
(3R)-3-[[amino-(1-benzhydrylazetidin-3-yl)methylidene]amino]oxycarbonyl-6-cyclohexylhexanoic acid (PubChem CID 173184371) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is (3R)-3-[[amino-(1-benzhydrylazetidin-3-yl)methylidene]amino]oxycarbonyl-6-cyclohexylhexanoic acid.
| Compound Name | (3R)-3-[[amino-(1-benzhydrylazetidin-3-yl)methylidene]amino]oxycarbonyl-6-cyclohexylhexanoic acid |
|---|---|
| PubChem CID | 173184371 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | (3R)-3-[[amino-(1-benzhydrylazetidin-3-yl)methylidene]amino]oxycarbonyl-6-cyclohexylhexanoic acid |
| SMILES | NC(=NOC(=O)[C@H](CCCC1CCCCC1)CC(=O)O)C1CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C30H39N3O4/c31-29(32-37-30(36)25(19-27(34)35)18-10-13-22-11-4-1-5-12-22)26-20-33(21-26)28(23-14-6-2-7-15-23)24-16-8-3-9-17-24/h2-3,6-9,14-17,22,25-26,28H,1,4-5,10-13,18-21H2,(H2,31,32)(H,34,35)/t25-/m1/s1 |
| InChIKey | VNYHOUUSTKQUCD-RUZDIDTESA-N |
| XLogP | 5.36 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|