C41H67N3O8 — CID 172930278
1-O-[(Z)-(1-amino-2-pyridin-4-ylethylidene)amino] 4-O-tert-butyl (2R)-2-(3-cyclohexylpropyl)butanedioate;(2R)-5-cyclohexyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid (PubChem CID 172930278) has the molecular formula C41H67N3O8 and a molecular weight of 730.00 g/mol. Its IUPAC name is 1-O-[(Z)-(1-amino-2-pyridin-4-ylethylidene)amino] 4-O-tert-butyl (2R)-2-(3-cyclohexylpropyl)butanedioate;(2R)-5-cyclohexyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid.
| Compound Name | 1-O-[(Z)-(1-amino-2-pyridin-4-ylethylidene)amino] 4-O-tert-butyl (2R)-2-(3-cyclohexylpropyl)butanedioate;(2R)-5-cyclohexyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid |
|---|---|
| PubChem CID | 172930278 |
| Molecular Formula | C41H67N3O8 |
| Molecular Weight | 730.00 g/mol |
| Exact Mass | 729.49 |
| IUPAC Name | 1-O-[(Z)-(1-amino-2-pyridin-4-ylethylidene)amino] 4-O-tert-butyl (2R)-2-(3-cyclohexylpropyl)butanedioate;(2R)-5-cyclohexyl-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CCCC1CCCCC1)C(=O)O.CC(C)(C)OC(=O)C[C@@H](CCCC1CCCCC1)C(=O)O/N=C(\N)Cc1ccncc1 |
| InChI | InChI=1S/C24H37N3O4.C17H30O4/c1-24(2,3)30-22(28)17-20(11-7-10-18-8-5-4-6-9-18)23(29)31-27-21(25)16-19-12-14-26-15-13-19;1-17(2,3)21-15(18)12-14(16(19)20)11-7-10-13-8-5-4-6-9-13/h12-15,18,20H,4-11,16-17H2,1-3H3,(H2,25,27);13-14H,4-12H2,1-3H3,(H,19,20)/t20-;14-/m11/s1 |
| InChIKey | NKSGSNOJUSXOJK-VVMLIRAMSA-N |
| XLogP | 8.71 |
| TPSA | 167.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.00 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|