C19H30O5 — CID 22168332
2-[2-(2,4-diethyl-4-methylhexyl)peroxyphenoxy]acetic acid (PubChem CID 22168332) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-[2-(2,4-diethyl-4-methylhexyl)peroxyphenoxy]acetic acid.
| Compound Name | 2-[2-(2,4-diethyl-4-methylhexyl)peroxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 22168332 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[2-(2,4-diethyl-4-methylhexyl)peroxyphenoxy]acetic acid |
| SMILES | CCC(COOc1ccccc1OCC(=O)O)CC(C)(CC)CC |
| InChI | InChI=1S/C19H30O5/c1-5-15(12-19(4,6-2)7-3)13-23-24-17-11-9-8-10-16(17)22-14-18(20)21/h8-11,15H,5-7,12-14H2,1-4H3,(H,20,21) |
| InChIKey | LHGLAVXPLHQMHJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|