About (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate
(4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate (PubChem CID 165041539) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate.
Analyze (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate?
The IUPAC name of (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate (CID 165041539) is (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate.
What is the SMILES notation for (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate?
The canonical SMILES for (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate is CCOC(C)(C)CC(=O)OC(C)(C)CC(C)(C)N.
What is the InChIKey of (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate?
The InChIKey is OEZQXNCNIDGLPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO3/c1-8-17-13(4,5)9-11(16)18-14(6,7)10-12(2,3)15/h8-10,15H2,1-7H3.
What are the key properties of (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate?
(4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate has a molecular weight of 259.39 g/mol, XLogP of 2.64, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2,4-dimethylpentan-2-yl) 3-ethoxy-3-methylbutanoate is sourced from PubChem (CID 165041539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).