C18H37N3O4 — CID 154979439
bis(4-amino-2,4-dimethylpentan-2-yl) 2-aminobutanedioate (PubChem CID 154979439) has the molecular formula C18H37N3O4 and a molecular weight of 359.51 g/mol. Its IUPAC name is bis(4-amino-2,4-dimethylpentan-2-yl) 2-aminobutanedioate.
| Compound Name | bis(4-amino-2,4-dimethylpentan-2-yl) 2-aminobutanedioate |
|---|---|
| PubChem CID | 154979439 |
| Molecular Formula | C18H37N3O4 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | bis(4-amino-2,4-dimethylpentan-2-yl) 2-aminobutanedioate |
| SMILES | CC(C)(N)CC(C)(C)OC(=O)CC(N)C(=O)OC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C18H37N3O4/c1-15(2,20)10-17(5,6)24-13(22)9-12(19)14(23)25-18(7,8)11-16(3,4)21/h12H,9-11,19-21H2,1-8H3 |
| InChIKey | IHDJNOKAANYMJR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |