C19H39N3O4 — CID 154979440
bis(4-amino-2,4-dimethylpentan-2-yl) 2-aminopentanedioate (PubChem CID 154979440) has the molecular formula C19H39N3O4 and a molecular weight of 373.54 g/mol. Its IUPAC name is bis(4-amino-2,4-dimethylpentan-2-yl) 2-aminopentanedioate.
| Compound Name | bis(4-amino-2,4-dimethylpentan-2-yl) 2-aminopentanedioate |
|---|---|
| PubChem CID | 154979440 |
| Molecular Formula | C19H39N3O4 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.29 |
| IUPAC Name | bis(4-amino-2,4-dimethylpentan-2-yl) 2-aminopentanedioate |
| SMILES | CC(C)(N)CC(C)(C)OC(=O)CCC(N)C(=O)OC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C19H39N3O4/c1-16(2,21)11-18(5,6)25-14(23)10-9-13(20)15(24)26-19(7,8)12-17(3,4)22/h13H,9-12,20-22H2,1-8H3 |
| InChIKey | NILNGFHAOLQLGZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |