C19H36N2O5 — CID 54259887
[2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl] 2-amino-9-(methylamino)-9-oxononanoate (PubChem CID 54259887) has the molecular formula C19H36N2O5 and a molecular weight of 372.51 g/mol. Its IUPAC name is [2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl] 2-amino-9-(methylamino)-9-oxononanoate.
| Compound Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl] 2-amino-9-(methylamino)-9-oxononanoate |
|---|---|
| PubChem CID | 54259887 |
| Molecular Formula | C19H36N2O5 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | [2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutan-2-yl] 2-amino-9-(methylamino)-9-oxononanoate |
| SMILES | CNC(=O)CCCCCCC(N)C(=O)OC(C)(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H36N2O5/c1-18(2,3)25-16(23)13-19(4,5)26-17(24)14(20)11-9-7-8-10-12-15(22)21-6/h14H,7-13,20H2,1-6H3,(H,21,22) |
| InChIKey | RCTGAKGBNFXDBN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|