C13H27INO2- — CID 163508677
(4-amino-2,4-dimethylpentan-2-yl) 4-methyliodanuidylpentanoate (PubChem CID 163508677) has the molecular formula C13H27INO2- and a molecular weight of 356.27 g/mol. Its IUPAC name is (4-amino-2,4-dimethylpentan-2-yl) 4-methyliodanuidylpentanoate.
| Compound Name | (4-amino-2,4-dimethylpentan-2-yl) 4-methyliodanuidylpentanoate |
|---|---|
| PubChem CID | 163508677 |
| Molecular Formula | C13H27INO2- |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (4-amino-2,4-dimethylpentan-2-yl) 4-methyliodanuidylpentanoate |
| SMILES | C[I-]C(C)CCC(=O)OC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C13H27INO2/c1-10(14-6)7-8-11(16)17-13(4,5)9-12(2,3)15/h10H,7-9,15H2,1-6H3/q-1 |
| InChIKey | IZBWWTGCYKNSHF-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|