About 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate
5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate (PubChem CID 155065000) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate.
Molecular Properties
| Compound Name | 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate |
| PubChem CID | 155065000 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate |
| SMILES | CCC(C)(C)OC(=O)CC[C@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C14H26O4/c1-7-14(5,6)18-12(15)9-8-11(4)13(16)17-10(2)3/h10-11H,7-9H2,1-6H3/t11-/m0/s1 |
| InChIKey | SDTPYNDCLSBNBT-NSHDSACASA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate?
The IUPAC name of 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate (CID 155065000) is 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate.
What is the SMILES notation for 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate?
The canonical SMILES for 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate is CCC(C)(C)OC(=O)CC[C@H](C)C(=O)OC(C)C.
What is the InChIKey of 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate?
The InChIKey is SDTPYNDCLSBNBT-NSHDSACASA-N. The full InChI is InChI=1S/C14H26O4/c1-7-14(5,6)18-12(15)9-8-11(4)13(16)17-10(2)3/h10-11H,7-9H2,1-6H3/t11-/m0/s1.
What are the key properties of 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate?
5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate has a molecular weight of 258.36 g/mol, XLogP of 3.09, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-(2-methylbutan-2-yl) 1-O-propan-2-yl (2S)-2-methylpentanedioate is sourced from PubChem (CID 155065000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).