C7H16N2O2S — CID 139681743
(1-amino-2-methylpropan-2-yl) (2R)-2-amino-3-sulfanylpropanoate (PubChem CID 139681743) has the molecular formula C7H16N2O2S and a molecular weight of 192.28 g/mol. Its IUPAC name is (1-amino-2-methylpropan-2-yl) (2R)-2-amino-3-sulfanylpropanoate.
| Compound Name | (1-amino-2-methylpropan-2-yl) (2R)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 139681743 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (1-amino-2-methylpropan-2-yl) (2R)-2-amino-3-sulfanylpropanoate |
| SMILES | CC(C)(CN)OC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C7H16N2O2S/c1-7(2,4-8)11-6(10)5(9)3-12/h5,12H,3-4,8-9H2,1-2H3/t5-/m0/s1 |
| InChIKey | QORCQKJSKGEUTC-YFKPBYRVSA-N |
| XLogP | -0.48 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|