C31H52O4 — CID 123215467
bis(4-ethyl-2,4-dimethylhex-5-yn-2-yl) 3,3,5,5-tetramethylheptanedioate (PubChem CID 123215467) has the molecular formula C31H52O4 and a molecular weight of 488.75 g/mol. Its IUPAC name is bis(4-ethyl-2,4-dimethylhex-5-yn-2-yl) 3,3,5,5-tetramethylheptanedioate.
| Compound Name | bis(4-ethyl-2,4-dimethylhex-5-yn-2-yl) 3,3,5,5-tetramethylheptanedioate |
|---|---|
| PubChem CID | 123215467 |
| Molecular Formula | C31H52O4 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | bis(4-ethyl-2,4-dimethylhex-5-yn-2-yl) 3,3,5,5-tetramethylheptanedioate |
| SMILES | C#CC(C)(CC)CC(C)(C)OC(=O)CC(C)(C)CC(C)(C)CC(=O)OC(C)(C)CC(C)(C#C)CC |
| InChI | InChI=1S/C31H52O4/c1-15-30(13,16-2)22-28(9,10)34-24(32)19-26(5,6)21-27(7,8)20-25(33)35-29(11,12)23-31(14,17-3)18-4/h1,3H,16,18-23H2,2,4-14H3 |
| InChIKey | NRLGPRRJLZZJDD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|