C11H21BrO2 — CID 89376029
methyl 5-bromo-3,3,5-trimethylheptanoate (PubChem CID 89376029) has the molecular formula C11H21BrO2 and a molecular weight of 265.19 g/mol. Its IUPAC name is methyl 5-bromo-3,3,5-trimethylheptanoate.
| Compound Name | methyl 5-bromo-3,3,5-trimethylheptanoate |
|---|---|
| PubChem CID | 89376029 |
| Molecular Formula | C11H21BrO2 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | methyl 5-bromo-3,3,5-trimethylheptanoate |
| SMILES | CCC(C)(Br)CC(C)(C)CC(=O)OC |
| InChI | InChI=1S/C11H21BrO2/c1-6-11(4,12)8-10(2,3)7-9(13)14-5/h6-8H2,1-5H3 |
| InChIKey | GSWIHPJNYVEQFI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|