C18H34O4S — CID 20558319
methyl 6-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanyl-3,3-dimethylhexanoate (PubChem CID 20558319) has the molecular formula C18H34O4S and a molecular weight of 346.53 g/mol. Its IUPAC name is methyl 6-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanyl-3,3-dimethylhexanoate.
| Compound Name | methyl 6-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanyl-3,3-dimethylhexanoate |
|---|---|
| PubChem CID | 20558319 |
| Molecular Formula | C18H34O4S |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | methyl 6-(6-methoxy-4,4-dimethyl-6-oxohexyl)sulfanyl-3,3-dimethylhexanoate |
| SMILES | COC(=O)CC(C)(C)CCCSCCCC(C)(C)CC(=O)OC |
| InChI | InChI=1S/C18H34O4S/c1-17(2,13-15(19)21-5)9-7-11-23-12-8-10-18(3,4)14-16(20)22-6/h7-14H2,1-6H3 |
| InChIKey | SMVPHISWHPQTDG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|