C13H20O6-2 — CID 21401700
2-(7-methoxy-5,5-dimethyl-7-oxoheptyl)propanedioate (PubChem CID 21401700) has the molecular formula C13H20O6-2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(7-methoxy-5,5-dimethyl-7-oxoheptyl)propanedioate.
| Compound Name | 2-(7-methoxy-5,5-dimethyl-7-oxoheptyl)propanedioate |
|---|---|
| PubChem CID | 21401700 |
| Molecular Formula | C13H20O6-2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(7-methoxy-5,5-dimethyl-7-oxoheptyl)propanedioate |
| SMILES | COC(=O)CC(C)(C)CCCCC(C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C13H22O6/c1-13(2,8-10(14)19-3)7-5-4-6-9(11(15)16)12(17)18/h9H,4-8H2,1-3H3,(H,15,16)(H,17,18)/p-2 |
| InChIKey | GGHAHUBXCKCZGE-UHFFFAOYSA-L |
| XLogP | -0.75 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|