C23H44O6 — CID 21303575
methyl 7-[3-(7-methoxy-5,5-dimethyl-7-oxoheptoxy)propoxy]-3,3-dimethylheptanoate (PubChem CID 21303575) has the molecular formula C23H44O6 and a molecular weight of 416.60 g/mol. Its IUPAC name is methyl 7-[3-(7-methoxy-5,5-dimethyl-7-oxoheptoxy)propoxy]-3,3-dimethylheptanoate.
| Compound Name | methyl 7-[3-(7-methoxy-5,5-dimethyl-7-oxoheptoxy)propoxy]-3,3-dimethylheptanoate |
|---|---|
| PubChem CID | 21303575 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | methyl 7-[3-(7-methoxy-5,5-dimethyl-7-oxoheptoxy)propoxy]-3,3-dimethylheptanoate |
| SMILES | COC(=O)CC(C)(C)CCCCOCCCOCCCCC(C)(C)CC(=O)OC |
| InChI | InChI=1S/C23H44O6/c1-22(2,18-20(24)26-5)12-7-9-14-28-16-11-17-29-15-10-8-13-23(3,4)19-21(25)27-6/h7-19H2,1-6H3 |
| InChIKey | DEKDPXVUTRXWEZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|