methyl 3-(10,10,10-trifluorodecoxy)propanoate

C14H25F3O3 — CID 151180668

IUPACmethyl 3-(10,10,10-trifluorodecoxy)propanoate
SMILESCOC(=O)CCOCCCCCCCCCC(F)(F)F
InChIInChI=1S/C14H25F3O3/c1-19-13(18)9-12-20-11-8-6-4-2-3-5-7-10-14(15,16)17/h2-12H2,1H3
InChIKeyNEFMVKHJYLQBRF-UHFFFAOYSA-N
MW298.34 g/mol
LogP4.25
Rot. Bonds12

About methyl 3-(10,10,10-trifluorodecoxy)propanoate

methyl 3-(10,10,10-trifluorodecoxy)propanoate (PubChem CID 151180668) has the molecular formula C14H25F3O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl 3-(10,10,10-trifluorodecoxy)propanoate.

Molecular Properties

Compound Namemethyl 3-(10,10,10-trifluorodecoxy)propanoate
PubChem CID151180668
Molecular FormulaC14H25F3O3
Molecular Weight298.34 g/mol
Exact Mass298.18
IUPAC Namemethyl 3-(10,10,10-trifluorodecoxy)propanoate
SMILESCOC(=O)CCOCCCCCCCCCC(F)(F)F
InChIInChI=1S/C14H25F3O3/c1-19-13(18)9-12-20-11-8-6-4-2-3-5-7-10-14(15,16)17/h2-12H2,1H3
InChIKeyNEFMVKHJYLQBRF-UHFFFAOYSA-N
XLogP4.25
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds12
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.34
LogP ≤ 54.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 3-(10,10,10-trifluorodecoxy)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(10,10,10-trifluorodecoxy)propanoate?
The IUPAC name of methyl 3-(10,10,10-trifluorodecoxy)propanoate (CID 151180668) is methyl 3-(10,10,10-trifluorodecoxy)propanoate.
What is the SMILES notation for methyl 3-(10,10,10-trifluorodecoxy)propanoate?
The canonical SMILES for methyl 3-(10,10,10-trifluorodecoxy)propanoate is COC(=O)CCOCCCCCCCCCC(F)(F)F.
What is the InChIKey of methyl 3-(10,10,10-trifluorodecoxy)propanoate?
The InChIKey is NEFMVKHJYLQBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F3O3/c1-19-13(18)9-12-20-11-8-6-4-2-3-5-7-10-14(15,16)17/h2-12H2,1H3.
What are the key properties of methyl 3-(10,10,10-trifluorodecoxy)propanoate?
methyl 3-(10,10,10-trifluorodecoxy)propanoate has a molecular weight of 298.34 g/mol, XLogP of 4.25, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(10,10,10-trifluorodecoxy)propanoate is sourced from PubChem (CID 151180668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).